C22H21Cl2N5O5S — CID 155058630
N-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[[4-(prop-2-enoylamino)oxolan-3-yl]amino]thieno[3,2-d]pyrimidine-6-carboxamide (PubChem CID 155058630) has the molecular formula C22H21Cl2N5O5S and a molecular weight of 538.41 g/mol. Its IUPAC name is N-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[[4-(prop-2-enoylamino)oxolan-3-yl]amino]thieno[3,2-d]pyrimidine-6-carboxamide.
| Compound Name | N-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[[4-(prop-2-enoylamino)oxolan-3-yl]amino]thieno[3,2-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155058630 |
| Molecular Formula | C22H21Cl2N5O5S |
| Molecular Weight | 538.41 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | N-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[[4-(prop-2-enoylamino)oxolan-3-yl]amino]thieno[3,2-d]pyrimidine-6-carboxamide |
| SMILES | C=CC(=O)NC1COCC1Nc1ncc2sc(C(=O)Nc3c(Cl)c(OC)cc(OC)c3Cl)cc2n1 |
| InChI | InChI=1S/C22H21Cl2N5O5S/c1-4-17(30)26-11-8-34-9-12(11)28-22-25-7-16-10(27-22)5-15(35-16)21(31)29-20-18(23)13(32-2)6-14(33-3)19(20)24/h4-7,11-12H,1,8-9H2,2-3H3,(H,26,30)(H,29,31)(H,25,27,28) |
| InChIKey | RLAKGDHBKGRGBG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|