C22H23Cl2N5O4 — CID 155058493
N-[4-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methyl]pyrrolo[3,2-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 155058493) has the molecular formula C22H23Cl2N5O4 and a molecular weight of 492.36 g/mol. Its IUPAC name is N-[4-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methyl]pyrrolo[3,2-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[4-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methyl]pyrrolo[3,2-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 155058493 |
| Molecular Formula | C22H23Cl2N5O4 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[4-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methyl]pyrrolo[3,2-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1COCC1Nc1ncc2c(ccn2Cc2c(Cl)c(OC)cc(OC)c2Cl)n1 |
| InChI | InChI=1S/C22H23Cl2N5O4/c1-4-19(30)26-14-10-33-11-15(14)28-22-25-8-16-13(27-22)5-6-29(16)9-12-20(23)17(31-2)7-18(32-3)21(12)24/h4-8,14-15H,1,9-11H2,2-3H3,(H,26,30)(H,25,27,28) |
| InChIKey | ZGVHASUZPNKLGC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|