C23H21Cl2FN4O4 — CID 118041422
N-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-fluoroquinazolin-2-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 118041422) has the molecular formula C23H21Cl2FN4O4 and a molecular weight of 507.35 g/mol. Its IUPAC name is N-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-fluoroquinazolin-2-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-fluoroquinazolin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118041422 |
| Molecular Formula | C23H21Cl2FN4O4 |
| Molecular Weight | 507.35 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | N-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-fluoroquinazolin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc(F)c2n1 |
| InChI | InChI=1S/C23H21Cl2FN4O4/c1-4-18(31)28-14-9-34-10-15(14)29-23-27-8-12-5-11(6-13(26)22(12)30-23)19-20(24)16(32-2)7-17(33-3)21(19)25/h4-8,14-15H,1,9-10H2,2-3H3,(H,28,31)(H,27,29,30)/t14-,15+/m0/s1 |
| InChIKey | SOLUFOPZJNIJOS-LSDHHAIUSA-N |
| XLogP | 4.24 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|