C24H24Cl2N4O4 — CID 123460950
N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-4-hydroxycyclopentyl]prop-2-enamide (PubChem CID 123460950) has the molecular formula C24H24Cl2N4O4 and a molecular weight of 503.39 g/mol. Its IUPAC name is N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-4-hydroxycyclopentyl]prop-2-enamide.
| Compound Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-4-hydroxycyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 123460950 |
| Molecular Formula | C24H24Cl2N4O4 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-4-hydroxycyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC(O)CC1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C24H24Cl2N4O4/c1-4-20(32)28-16-8-14(31)9-17(16)30-24-27-11-13-7-12(5-6-15(13)29-24)21-22(25)18(33-2)10-19(34-3)23(21)26/h4-7,10-11,14,16-17,31H,1,8-9H2,2-3H3,(H,28,32)(H,27,29,30) |
| InChIKey | FRVZTFULMVCLRE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|