C27H29Cl2N5O6 — CID 142732433
(1S,3R,4S)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-N,N-dimethoxy-4-(prop-2-enoylamino)cyclopentane-1-carboxamide (PubChem CID 142732433) has the molecular formula C27H29Cl2N5O6 and a molecular weight of 590.46 g/mol. Its IUPAC name is (1S,3R,4S)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-N,N-dimethoxy-4-(prop-2-enoylamino)cyclopentane-1-carboxamide.
| Compound Name | (1S,3R,4S)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-N,N-dimethoxy-4-(prop-2-enoylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 142732433 |
| Molecular Formula | C27H29Cl2N5O6 |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | (1S,3R,4S)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-N,N-dimethoxy-4-(prop-2-enoylamino)cyclopentane-1-carboxamide |
| SMILES | C=CC(=O)N[C@H]1C[C@@H](C(=O)N(OC)OC)C[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C27H29Cl2N5O6/c1-6-22(35)31-18-10-15(26(36)34(39-4)40-5)11-19(18)33-27-30-13-16-9-14(7-8-17(16)32-27)23-24(28)20(37-2)12-21(38-3)25(23)29/h6-9,12-13,15,18-19H,1,10-11H2,2-5H3,(H,31,35)(H,30,32,33)/t15-,18+,19-/m1/s1 |
| InChIKey | QJKQUXAZHGFRPY-AYOQOUSVSA-N |
| XLogP | 4.43 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|