C28H31Cl2N5O3 — CID 163447691
(1S,3R,4S)-3-[[6-(2,6-dichloro-3-ethyl-5-methoxyphenyl)quinazolin-2-yl]amino]-N,N-dimethyl-4-(prop-2-enoylamino)cyclopentane-1-carboxamide (PubChem CID 163447691) has the molecular formula C28H31Cl2N5O3 and a molecular weight of 556.49 g/mol. Its IUPAC name is (1S,3R,4S)-3-[[6-(2,6-dichloro-3-ethyl-5-methoxyphenyl)quinazolin-2-yl]amino]-N,N-dimethyl-4-(prop-2-enoylamino)cyclopentane-1-carboxamide.
| Compound Name | (1S,3R,4S)-3-[[6-(2,6-dichloro-3-ethyl-5-methoxyphenyl)quinazolin-2-yl]amino]-N,N-dimethyl-4-(prop-2-enoylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 163447691 |
| Molecular Formula | C28H31Cl2N5O3 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | (1S,3R,4S)-3-[[6-(2,6-dichloro-3-ethyl-5-methoxyphenyl)quinazolin-2-yl]amino]-N,N-dimethyl-4-(prop-2-enoylamino)cyclopentane-1-carboxamide |
| SMILES | C=CC(=O)N[C@H]1C[C@@H](C(=O)N(C)C)C[C@H]1Nc1ncc2cc(-c3c(Cl)c(CC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C28H31Cl2N5O3/c1-6-15-13-22(38-5)26(30)24(25(15)29)16-8-9-19-18(10-16)14-31-28(33-19)34-21-12-17(27(37)35(3)4)11-20(21)32-23(36)7-2/h7-10,13-14,17,20-21H,2,6,11-12H2,1,3-5H3,(H,32,36)(H,31,33,34)/t17-,20+,21-/m1/s1 |
| InChIKey | NZOJYBCJYGCDAO-JRGCBEDISA-N |
| XLogP | 5.12 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|