C26H26Cl2N4O3 — CID 146529122
N-[(1S,2R,3S,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-6-methyl-3-bicyclo[3.1.0]hexanyl]prop-2-enamide (PubChem CID 146529122) has the molecular formula C26H26Cl2N4O3 and a molecular weight of 513.43 g/mol. Its IUPAC name is N-[(1S,2R,3S,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-6-methyl-3-bicyclo[3.1.0]hexanyl]prop-2-enamide.
| Compound Name | N-[(1S,2R,3S,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-6-methyl-3-bicyclo[3.1.0]hexanyl]prop-2-enamide |
|---|---|
| PubChem CID | 146529122 |
| Molecular Formula | C26H26Cl2N4O3 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | N-[(1S,2R,3S,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-6-methyl-3-bicyclo[3.1.0]hexanyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1C[C@@H]2C(C)[C@@H]2[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C26H26Cl2N4O3/c1-5-20(33)30-17-9-15-12(2)21(15)25(17)32-26-29-11-14-8-13(6-7-16(14)31-26)22-23(27)18(34-3)10-19(35-4)24(22)28/h5-8,10-12,15,17,21,25H,1,9H2,2-4H3,(H,30,33)(H,29,31,32)/t12?,15-,17+,21+,25+/m1/s1 |
| InChIKey | OKKIYHAULLSHKP-WLPXSTGSSA-N |
| XLogP | 5.36 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|