C22H24Cl2N4O2 — CID 166829234
(1S,2R,4R)-2-N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]-4-methylcyclopentane-1,2-diamine (PubChem CID 166829234) has the molecular formula C22H24Cl2N4O2 and a molecular weight of 447.37 g/mol. Its IUPAC name is (1S,2R,4R)-2-N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]-4-methylcyclopentane-1,2-diamine.
| Compound Name | (1S,2R,4R)-2-N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]-4-methylcyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 166829234 |
| Molecular Formula | C22H24Cl2N4O2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (1S,2R,4R)-2-N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]-4-methylcyclopentane-1,2-diamine |
| SMILES | COc1cc(OC)c(Cl)c(-c2ccc3nc(N[C@@H]4C[C@H](C)C[C@@H]4N)ncc3c2)c1Cl |
| InChI | InChI=1S/C22H24Cl2N4O2/c1-11-6-14(25)16(7-11)28-22-26-10-13-8-12(4-5-15(13)27-22)19-20(23)17(29-2)9-18(30-3)21(19)24/h4-5,8-11,14,16H,6-7,25H2,1-3H3,(H,26,27,28)/t11-,14+,16-/m1/s1 |
| InChIKey | FITXTLREIROGKM-DIOULYMOSA-N |
| XLogP | 5.16 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |