C23H22Cl2N4O4 — CID 118036245
[(1S,2R,3S,5S)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-bicyclo[3.1.0]hexanyl]carbamic acid (PubChem CID 118036245) has the molecular formula C23H22Cl2N4O4 and a molecular weight of 489.36 g/mol. Its IUPAC name is [(1S,2R,3S,5S)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-bicyclo[3.1.0]hexanyl]carbamic acid.
| Compound Name | [(1S,2R,3S,5S)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-bicyclo[3.1.0]hexanyl]carbamic acid |
|---|---|
| PubChem CID | 118036245 |
| Molecular Formula | C23H22Cl2N4O4 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | [(1S,2R,3S,5S)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-bicyclo[3.1.0]hexanyl]carbamic acid |
| SMILES | COc1cc(OC)c(Cl)c(-c2ccc3nc(N[C@@H]4[C@H]5C[C@H]5C[C@@H]4NC(=O)O)ncc3c2)c1Cl |
| InChI | InChI=1S/C23H22Cl2N4O4/c1-32-16-8-17(33-2)20(25)18(19(16)24)10-3-4-14-12(5-10)9-26-22(27-14)29-21-13-6-11(13)7-15(21)28-23(30)31/h3-5,8-9,11,13,15,21,28H,6-7H2,1-2H3,(H,30,31)(H,26,27,29)/t11-,13-,15-,21+/m0/s1 |
| InChIKey | ZPYFAALHROPIIK-OORNIURLSA-N |
| XLogP | 5.08 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |