C25H24Cl2N4O3 — CID 118036416
N-[(1S,2S,3S,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-bicyclo[3.1.0]hexanyl]prop-2-enamide (PubChem CID 118036416) has the molecular formula C25H24Cl2N4O3 and a molecular weight of 499.40 g/mol. Its IUPAC name is N-[(1S,2S,3S,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-bicyclo[3.1.0]hexanyl]prop-2-enamide.
| Compound Name | N-[(1S,2S,3S,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-bicyclo[3.1.0]hexanyl]prop-2-enamide |
|---|---|
| PubChem CID | 118036416 |
| Molecular Formula | C25H24Cl2N4O3 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | N-[(1S,2S,3S,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-bicyclo[3.1.0]hexanyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1C[C@H]2C[C@@H]2[C@@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C25H24Cl2N4O3/c1-4-20(32)29-17-9-13-8-15(13)24(17)31-25-28-11-14-7-12(5-6-16(14)30-25)21-22(26)18(33-2)10-19(34-3)23(21)27/h4-7,10-11,13,15,17,24H,1,8-9H2,2-3H3,(H,29,32)(H,28,30,31)/t13-,15+,17+,24+/m1/s1 |
| InChIKey | XPVXYRSHKDONOY-OOECHRAUSA-N |
| XLogP | 5.11 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|