C25H27Cl2N5O4S — CID 144836172
N-[4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-1-ethylsulfinylpyrrolidin-3-yl]prop-2-enamide (PubChem CID 144836172) has the molecular formula C25H27Cl2N5O4S and a molecular weight of 564.50 g/mol. Its IUPAC name is N-[4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-1-ethylsulfinylpyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-1-ethylsulfinylpyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 144836172 |
| Molecular Formula | C25H27Cl2N5O4S |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | N-[4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-1-ethylsulfinylpyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CN(S(=O)CC)CC1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C25H27Cl2N5O4S/c1-5-21(33)29-17-12-32(37(34)6-2)13-18(17)31-25-28-11-15-9-14(7-8-16(15)30-25)22-23(26)19(35-3)10-20(36-4)24(22)27/h5,7-11,17-18H,1,6,12-13H2,2-4H3,(H,29,33)(H,28,30,31) |
| InChIKey | NULYHAQSSNNANG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|