C27H31ClN4O3 — CID 142295688
1-[4-[[6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 142295688) has the molecular formula C27H31ClN4O3 and a molecular weight of 495.02 g/mol. Its IUPAC name is 1-[4-[[6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142295688 |
| Molecular Formula | C27H31ClN4O3 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 1-[4-[[6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2ncc3cc(-c4c(Cl)c(OC)cc(OC)c4CC)ccc3n2)C(C)C1 |
| InChI | InChI=1S/C27H31ClN4O3/c1-6-19-22(34-4)13-23(35-5)26(28)25(19)17-8-9-21-18(12-17)14-29-27(31-21)30-20-10-11-32(15-16(20)3)24(33)7-2/h7-9,12-14,16,20H,2,6,10-11,15H2,1,3-5H3,(H,29,30,31) |
| InChIKey | SDCROBFJWNWGMH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|