C26H27Cl2N3O3 — CID 157301251
1-[(3R,4R)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]methyl]-4-ethylpyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 157301251) has the molecular formula C26H27Cl2N3O3 and a molecular weight of 500.43 g/mol. Its IUPAC name is 1-[(3R,4R)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]methyl]-4-ethylpyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,4R)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]methyl]-4-ethylpyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 157301251 |
| Molecular Formula | C26H27Cl2N3O3 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 1-[(3R,4R)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]methyl]-4-ethylpyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](CC)[C@@H](Cc2ncc3cc(-c4c(Cl)c(OC)cc(OC)c4Cl)ccc3n2)C1 |
| InChI | InChI=1S/C26H27Cl2N3O3/c1-5-15-13-31(23(32)6-2)14-18(15)10-22-29-12-17-9-16(7-8-19(17)30-22)24-25(27)20(33-3)11-21(34-4)26(24)28/h6-9,11-12,15,18H,2,5,10,13-14H2,1,3-4H3/t15-,18-/m0/s1 |
| InChIKey | UUGTYUURXKADNI-YJBOKZPZSA-N |
| XLogP | 5.83 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|