C26H24Cl2N4O3 — CID 158079276
2-[(2S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]methyl]-1-prop-2-enoylpyrrolidin-2-yl]acetonitrile (PubChem CID 158079276) has the molecular formula C26H24Cl2N4O3 and a molecular weight of 511.41 g/mol. Its IUPAC name is 2-[(2S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]methyl]-1-prop-2-enoylpyrrolidin-2-yl]acetonitrile.
| Compound Name | 2-[(2S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]methyl]-1-prop-2-enoylpyrrolidin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 158079276 |
| Molecular Formula | C26H24Cl2N4O3 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 2-[(2S,4R)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]methyl]-1-prop-2-enoylpyrrolidin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1C[C@@H](Cc2ncc3cc(-c4c(Cl)c(OC)cc(OC)c4Cl)ccc3n2)C[C@H]1CC#N |
| InChI | InChI=1S/C26H24Cl2N4O3/c1-4-23(33)32-14-15(9-18(32)7-8-29)10-22-30-13-17-11-16(5-6-19(17)31-22)24-25(27)20(34-2)12-21(35-3)26(24)28/h4-6,11-13,15,18H,1,7,9-10,14H2,2-3H3/t15-,18-/m1/s1 |
| InChIKey | FMTCDMOZMGXWAY-CRAIPNDOSA-N |
| XLogP | 5.48 |
| TPSA | 88.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|