C23H24Cl2N4O3 — CID 123535657
3-N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]-4-N-prop-2-enyloxolane-3,4-diamine (PubChem CID 123535657) has the molecular formula C23H24Cl2N4O3 and a molecular weight of 475.38 g/mol. Its IUPAC name is 3-N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]-4-N-prop-2-enyloxolane-3,4-diamine.
| Compound Name | 3-N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]-4-N-prop-2-enyloxolane-3,4-diamine |
|---|---|
| PubChem CID | 123535657 |
| Molecular Formula | C23H24Cl2N4O3 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3-N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]-4-N-prop-2-enyloxolane-3,4-diamine |
| SMILES | C=CCNC1COCC1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C23H24Cl2N4O3/c1-4-7-26-16-11-32-12-17(16)29-23-27-10-14-8-13(5-6-15(14)28-23)20-21(24)18(30-2)9-19(31-3)22(20)25/h4-6,8-10,16-17,26H,1,7,11-12H2,2-3H3,(H,27,28,29) |
| InChIKey | BCFDYHUEYLRZDY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|