C23H22Cl2N4O4 — CID 175692558
2-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 175692558) has the molecular formula C23H22Cl2N4O4 and a molecular weight of 489.36 g/mol. Its IUPAC name is 2-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | 2-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 175692558 |
| Molecular Formula | C23H22Cl2N4O4 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 2-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=C(C(N)=O)[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C23H22Cl2N4O4/c1-11(22(26)30)14-9-33-10-16(14)29-23-27-8-13-6-12(4-5-15(13)28-23)19-20(24)17(31-2)7-18(32-3)21(19)25/h4-8,14,16H,1,9-10H2,2-3H3,(H2,26,30)(H,27,28,29)/t14-,16-/m1/s1 |
| InChIKey | HNDVMIOLTQGTCA-GDBMZVCRSA-N |
| XLogP | 4.09 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|