C22H20Cl3N5O4 — CID 153327688
2-[(3R,4S)-4-[[8-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 153327688) has the molecular formula C22H20Cl3N5O4 and a molecular weight of 524.79 g/mol. Its IUPAC name is 2-[(3R,4S)-4-[[8-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | 2-[(3R,4S)-4-[[8-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 153327688 |
| Molecular Formula | C22H20Cl3N5O4 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | 2-[(3R,4S)-4-[[8-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=C(C(N)=O)[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(Cl)c2n1 |
| InChI | InChI=1S/C22H20Cl3N5O4/c1-9(21(26)31)11-7-34-8-13(11)29-22-27-6-10-4-12(28-20(25)19(10)30-22)16-17(23)14(32-2)5-15(33-3)18(16)24/h4-6,11,13H,1,7-8H2,2-3H3,(H2,26,31)(H,27,29,30)/t11-,13-/m1/s1 |
| InChIKey | DOEPVHFLEMYUEH-DGCLKSJQSA-N |
| XLogP | 4.14 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|