C30H29Cl2N5O4 — CID 158268660
1-[(3R,4S)-4-[[8-(benzylamino)-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one (PubChem CID 158268660) has the molecular formula C30H29Cl2N5O4 and a molecular weight of 594.50 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[[8-(benzylamino)-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one.
| Compound Name | 1-[(3R,4S)-4-[[8-(benzylamino)-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 158268660 |
| Molecular Formula | C30H29Cl2N5O4 |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | 1-[(3R,4S)-4-[[8-(benzylamino)-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(NCc3ccccc3)c2n1 |
| InChI | InChI=1S/C30H29Cl2N5O4/c1-4-20(38)10-19-15-41-16-22(19)36-30-34-14-18-11-21(25-26(31)23(39-2)12-24(40-3)27(25)32)35-29(28(18)37-30)33-13-17-8-6-5-7-9-17/h4-9,11-12,14,19,22H,1,10,13,15-16H2,2-3H3,(H,33,35)(H,34,36,37)/t19-,22+/m0/s1 |
| InChIKey | ZWTAPIFOOLILCZ-SIKLNZKXSA-N |
| XLogP | 6.20 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|