C29H33Cl2N5O3 — CID 118041526
N-[(1S,2R,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-5-[1-(dimethylamino)ethenyl]cyclohexyl]prop-2-enamide (PubChem CID 118041526) has the molecular formula C29H33Cl2N5O3 and a molecular weight of 570.52 g/mol. Its IUPAC name is N-[(1S,2R,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-5-[1-(dimethylamino)ethenyl]cyclohexyl]prop-2-enamide.
| Compound Name | N-[(1S,2R,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-5-[1-(dimethylamino)ethenyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 118041526 |
| Molecular Formula | C29H33Cl2N5O3 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | N-[(1S,2R,5R)-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-5-[1-(dimethylamino)ethenyl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1C[C@H](C(=C)N(C)C)CC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C29H33Cl2N5O3/c1-7-25(37)33-22-13-17(16(2)36(3)4)8-11-21(22)35-29-32-15-19-12-18(9-10-20(19)34-29)26-27(30)23(38-5)14-24(39-6)28(26)31/h7,9-10,12,14-15,17,21-22H,1-2,8,11,13H2,3-6H3,(H,33,37)(H,32,34,35)/t17-,21-,22+/m1/s1 |
| InChIKey | DHRFWGJBZUSZGP-YHYVQYDKSA-N |
| XLogP | 5.95 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|