C25H24Cl3N5O4 — CID 146530172
3-[2,4-dichloro-5-methoxy-3-[2-[[4-(prop-2-enoylamino)pyrrolidin-3-yl]amino]quinazolin-6-yl]phenoxy]propanoyl chloride (PubChem CID 146530172) has the molecular formula C25H24Cl3N5O4 and a molecular weight of 564.86 g/mol. Its IUPAC name is 3-[2,4-dichloro-5-methoxy-3-[2-[[4-(prop-2-enoylamino)pyrrolidin-3-yl]amino]quinazolin-6-yl]phenoxy]propanoyl chloride.
| Compound Name | 3-[2,4-dichloro-5-methoxy-3-[2-[[4-(prop-2-enoylamino)pyrrolidin-3-yl]amino]quinazolin-6-yl]phenoxy]propanoyl chloride |
|---|---|
| PubChem CID | 146530172 |
| Molecular Formula | C25H24Cl3N5O4 |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | 3-[2,4-dichloro-5-methoxy-3-[2-[[4-(prop-2-enoylamino)pyrrolidin-3-yl]amino]quinazolin-6-yl]phenoxy]propanoyl chloride |
| SMILES | C=CC(=O)NC1CNCC1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OCCC(=O)Cl)c3Cl)ccc2n1 |
| InChI | InChI=1S/C25H24Cl3N5O4/c1-3-21(35)31-16-11-29-12-17(16)33-25-30-10-14-8-13(4-5-15(14)32-25)22-23(27)18(36-2)9-19(24(22)28)37-7-6-20(26)34/h3-5,8-10,16-17,29H,1,6-7,11-12H2,2H3,(H,31,35)(H,30,32,33) |
| InChIKey | XKOQEOWYSWYQFC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|