C24H23Cl3N4O4 — CID 123326292
N-[3-[[8-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]oxan-4-yl]prop-2-enamide (PubChem CID 123326292) has the molecular formula C24H23Cl3N4O4 and a molecular weight of 537.83 g/mol. Its IUPAC name is N-[3-[[8-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]oxan-4-yl]prop-2-enamide.
| Compound Name | N-[3-[[8-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 123326292 |
| Molecular Formula | C24H23Cl3N4O4 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | N-[3-[[8-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]oxan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCOCC1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C24H23Cl3N4O4/c1-4-19(32)29-15-5-6-35-11-16(15)30-24-28-10-13-7-12(8-14(25)23(13)31-24)20-21(26)17(33-2)9-18(34-3)22(20)27/h4,7-10,15-16H,1,5-6,11H2,2-3H3,(H,29,32)(H,28,30,31) |
| InChIKey | AWQOOPSJCUIVQO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|