C28H31Cl2N7O4 — CID 174010736
N-[(3S,4S)-3-[[8-[3-amino-2-(methyliminomethyl)prop-2-enyl]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]prop-2-enamide (PubChem CID 174010736) has the molecular formula C28H31Cl2N7O4 and a molecular weight of 600.51 g/mol. Its IUPAC name is N-[(3S,4S)-3-[[8-[3-amino-2-(methyliminomethyl)prop-2-enyl]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]prop-2-enamide.
| Compound Name | N-[(3S,4S)-3-[[8-[3-amino-2-(methyliminomethyl)prop-2-enyl]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 174010736 |
| Molecular Formula | C28H31Cl2N7O4 |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | N-[(3S,4S)-3-[[8-[3-amino-2-(methyliminomethyl)prop-2-enyl]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCOC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(CC(=CN)/C=N/C)c2n1 |
| InChI | InChI=1S/C28H31Cl2N7O4/c1-5-23(38)35-17-6-7-41-14-20(17)36-28-33-13-16-9-18(24-25(29)21(39-3)10-22(40-4)26(24)30)34-19(27(16)37-28)8-15(11-31)12-32-2/h5,9-13,17,20H,1,6-8,14,31H2,2-4H3,(H,35,38)(H,33,36,37)/b15-11?,32-12+/t17-,20+/m0/s1 |
| InChIKey | ZPMVKNDMLBRHAO-KWBLDTJISA-N |
| XLogP | 3.97 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|