C24H23Cl2N3O5S — CID 155058234
N-[3-[[2-(2,6-dichloro-3,5-dimethoxybenzoyl)thieno[2,3-c]pyridin-5-yl]amino]oxan-4-yl]prop-2-enamide (PubChem CID 155058234) has the molecular formula C24H23Cl2N3O5S and a molecular weight of 536.44 g/mol. Its IUPAC name is N-[3-[[2-(2,6-dichloro-3,5-dimethoxybenzoyl)thieno[2,3-c]pyridin-5-yl]amino]oxan-4-yl]prop-2-enamide.
| Compound Name | N-[3-[[2-(2,6-dichloro-3,5-dimethoxybenzoyl)thieno[2,3-c]pyridin-5-yl]amino]oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 155058234 |
| Molecular Formula | C24H23Cl2N3O5S |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | N-[3-[[2-(2,6-dichloro-3,5-dimethoxybenzoyl)thieno[2,3-c]pyridin-5-yl]amino]oxan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCOCC1Nc1cc2cc(C(=O)c3c(Cl)c(OC)cc(OC)c3Cl)sc2cn1 |
| InChI | InChI=1S/C24H23Cl2N3O5S/c1-4-20(30)29-13-5-6-34-11-14(13)28-19-8-12-7-17(35-18(12)10-27-19)24(31)21-22(25)15(32-2)9-16(33-3)23(21)26/h4,7-10,13-14H,1,5-6,11H2,2-3H3,(H,27,28)(H,29,30) |
| InChIKey | TZDMTDFWGKHDEY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|