C23H21Cl2N3O5S2 — CID 155058628
N-[3-[[2-(2,6-dichloro-3,5-dimethoxybenzoyl)thieno[2,3-c]pyridin-5-yl]amino]oxan-4-yl]-2-sulfanylideneacetamide (PubChem CID 155058628) has the molecular formula C23H21Cl2N3O5S2 and a molecular weight of 554.48 g/mol. Its IUPAC name is N-[3-[[2-(2,6-dichloro-3,5-dimethoxybenzoyl)thieno[2,3-c]pyridin-5-yl]amino]oxan-4-yl]-2-sulfanylideneacetamide.
| Compound Name | N-[3-[[2-(2,6-dichloro-3,5-dimethoxybenzoyl)thieno[2,3-c]pyridin-5-yl]amino]oxan-4-yl]-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 155058628 |
| Molecular Formula | C23H21Cl2N3O5S2 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | N-[3-[[2-(2,6-dichloro-3,5-dimethoxybenzoyl)thieno[2,3-c]pyridin-5-yl]amino]oxan-4-yl]-2-sulfanylideneacetamide |
| SMILES | COc1cc(OC)c(Cl)c(C(=O)c2cc3cc(NC4COCCC4NC(=O)C=S)ncc3s2)c1Cl |
| InChI | InChI=1S/C23H21Cl2N3O5S2/c1-31-14-7-15(32-2)22(25)20(21(14)24)23(30)16-5-11-6-18(26-8-17(11)35-16)27-13-9-33-4-3-12(13)28-19(29)10-34/h5-8,10,12-13H,3-4,9H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | UWTLDYRCCYIIIZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|