C25H27Cl2N5O4 — CID 139451153
N-[(4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(ethylamino)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 139451153) has the molecular formula C25H27Cl2N5O4 and a molecular weight of 532.43 g/mol. Its IUPAC name is N-[(4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(ethylamino)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(ethylamino)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 139451153 |
| Molecular Formula | C25H27Cl2N5O4 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | N-[(4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(ethylamino)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1COC[C@H]1Nc1cc2c(NCC)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C25H27Cl2N5O4/c1-5-21(33)31-17-12-36-11-16(17)30-20-8-14-13(10-29-20)7-15(32-25(14)28-6-2)22-23(26)18(34-3)9-19(35-4)24(22)27/h5,7-10,16-17H,1,6,11-12H2,2-4H3,(H,28,32)(H,29,30)(H,31,33)/t16-,17?/m1/s1 |
| InChIKey | UBNPCYZKLUEILR-TZHYSIJRSA-N |
| XLogP | 4.53 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|