C29H33F2N5O5 — CID 135181426
N-[(3R,4S)-4-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-5-(2,6-dimethylmorpholin-4-yl)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 135181426) has the molecular formula C29H33F2N5O5 and a molecular weight of 569.61 g/mol. Its IUPAC name is N-[(3R,4S)-4-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-5-(2,6-dimethylmorpholin-4-yl)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-4-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-5-(2,6-dimethylmorpholin-4-yl)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135181426 |
| Molecular Formula | C29H33F2N5O5 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | N-[(3R,4S)-4-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-5-(2,6-dimethylmorpholin-4-yl)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1COC[C@H]1Nc1cc2c(N3CC(C)OC(C)C3)nc(-c3c(F)c(OC)cc(OC)c3F)cc2cn1 |
| InChI | InChI=1S/C29H33F2N5O5/c1-6-25(37)34-21-14-40-13-20(21)33-24-8-18-17(10-32-24)7-19(35-29(18)36-11-15(2)41-16(3)12-36)26-27(30)22(38-4)9-23(39-5)28(26)31/h6-10,15-16,20-21H,1,11-14H2,2-5H3,(H,32,33)(H,34,37)/t15?,16?,20-,21+/m1/s1 |
| InChIKey | PPKBWVFRKHAKTQ-XXZMUIKMSA-N |
| XLogP | 3.69 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|