C30H33Cl2N5O4 — CID 159338959
1-[(3S,4S)-1-acetyl-4-[[5-(cyclopropylmethylamino)-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]pyrrolidin-3-yl]but-3-en-2-one (PubChem CID 159338959) has the molecular formula C30H33Cl2N5O4 and a molecular weight of 598.53 g/mol. Its IUPAC name is 1-[(3S,4S)-1-acetyl-4-[[5-(cyclopropylmethylamino)-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]pyrrolidin-3-yl]but-3-en-2-one.
| Compound Name | 1-[(3S,4S)-1-acetyl-4-[[5-(cyclopropylmethylamino)-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]pyrrolidin-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 159338959 |
| Molecular Formula | C30H33Cl2N5O4 |
| Molecular Weight | 598.53 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | 1-[(3S,4S)-1-acetyl-4-[[5-(cyclopropylmethylamino)-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]pyrrolidin-3-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@H]1CN(C(C)=O)C[C@H]1Nc1cc2c(NCC3CC3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C30H33Cl2N5O4/c1-5-20(39)8-19-14-37(16(2)38)15-23(19)35-26-10-21-18(13-33-26)9-22(36-30(21)34-12-17-6-7-17)27-28(31)24(40-3)11-25(41-4)29(27)32/h5,9-11,13,17,19,23H,1,6-8,12,14-15H2,2-4H3,(H,33,35)(H,34,36)/t19-,23+/m0/s1 |
| InChIKey | LFWYTSYQBYAWGA-WMZHIEFXSA-N |
| XLogP | 5.85 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|