C32H41Cl2N7O4 — CID 135180481
N-[(3S,4R)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-2-ylmethylamino)-2,6-naphthyridin-3-yl]amino]-1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 135180481) has the molecular formula C32H41Cl2N7O4 and a molecular weight of 658.63 g/mol. Its IUPAC name is N-[(3S,4R)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-2-ylmethylamino)-2,6-naphthyridin-3-yl]amino]-1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S,4R)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-2-ylmethylamino)-2,6-naphthyridin-3-yl]amino]-1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180481 |
| Molecular Formula | C32H41Cl2N7O4 |
| Molecular Weight | 658.63 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | N-[(3S,4R)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(oxolan-2-ylmethylamino)-2,6-naphthyridin-3-yl]amino]-1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CN(CCN(C)C)C[C@H]1Nc1cc2c(NCC3CCCO3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C32H41Cl2N7O4/c1-6-28(42)38-24-18-41(10-9-40(2)3)17-23(24)37-27-13-21-19(15-35-27)12-22(39-32(21)36-16-20-8-7-11-45-20)29-30(33)25(43-4)14-26(44-5)31(29)34/h6,12-15,20,23-24H,1,7-11,16-18H2,2-5H3,(H,35,37)(H,36,39)(H,38,42)/t20?,23-,24+/m1/s1 |
| InChIKey | OIXUVROZCWZMPF-LZCZEWEUSA-N |
| XLogP | 4.54 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|