C28H30FN3O4 — CID 158145462
1-[(3S,4R)-3-[[7-(2-cyclopropyl-6-fluoro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]but-3-en-2-one (PubChem CID 158145462) has the molecular formula C28H30FN3O4 and a molecular weight of 491.56 g/mol. Its IUPAC name is 1-[(3S,4R)-3-[[7-(2-cyclopropyl-6-fluoro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]but-3-en-2-one.
| Compound Name | 1-[(3S,4R)-3-[[7-(2-cyclopropyl-6-fluoro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 158145462 |
| Molecular Formula | C28H30FN3O4 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 1-[(3S,4R)-3-[[7-(2-cyclopropyl-6-fluoro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@H]1CCOC[C@H]1Nc1cc2cnc(-c3c(F)c(OC)cc(OC)c3C3CC3)cc2cn1 |
| InChI | InChI=1S/C28H30FN3O4/c1-4-20(33)9-17-7-8-36-15-22(17)32-25-11-19-13-30-21(10-18(19)14-31-25)27-26(16-5-6-16)23(34-2)12-24(35-3)28(27)29/h4,10-14,16-17,22H,1,5-9,15H2,2-3H3,(H,31,32)/t17-,22-/m1/s1 |
| InChIKey | FYQPYMBNTVRIOX-VGOFRKELSA-N |
| XLogP | 5.29 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|