C28H30F2N4O5 — CID 160736775
1-[(3R,4S)-4-[[6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-(3-hydroxy-3-methylcyclobutyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one (PubChem CID 160736775) has the molecular formula C28H30F2N4O5 and a molecular weight of 540.57 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[[6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-(3-hydroxy-3-methylcyclobutyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one.
| Compound Name | 1-[(3R,4S)-4-[[6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-(3-hydroxy-3-methylcyclobutyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 160736775 |
| Molecular Formula | C28H30F2N4O5 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 1-[(3R,4S)-4-[[6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-(3-hydroxy-3-methylcyclobutyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(F)c(OC)cc(OC)c3F)nc(C3CC(C)(O)C3)c2n1 |
| InChI | InChI=1S/C28H30F2N4O5/c1-5-17(35)6-15-12-39-13-19(15)33-27-31-11-14-7-18(22-23(29)20(37-3)8-21(38-4)24(22)30)32-26(25(14)34-27)16-9-28(2,36)10-16/h5,7-8,11,15-16,19,36H,1,6,9-10,12-13H2,2-4H3,(H,31,33,34)/t15-,16?,19+,28?/m0/s1 |
| InChIKey | JKQMWRVZXUHNDL-WPGUIWPXSA-N |
| XLogP | 4.19 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|