C27H29F2N5O4 — CID 159322782
1-[(3R,4S)-4-[[4-(cyclopropylmethylamino)-2-(2,6-difluoro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]but-3-en-2-one (PubChem CID 159322782) has the molecular formula C27H29F2N5O4 and a molecular weight of 525.56 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[[4-(cyclopropylmethylamino)-2-(2,6-difluoro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]but-3-en-2-one.
| Compound Name | 1-[(3R,4S)-4-[[4-(cyclopropylmethylamino)-2-(2,6-difluoro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 159322782 |
| Molecular Formula | C27H29F2N5O4 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 1-[(3R,4S)-4-[[4-(cyclopropylmethylamino)-2-(2,6-difluoro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@H]1COC[C@H]1Nc1cc2c(NCC3CC3)nc(-c3c(F)c(OC)cc(OC)c3F)nc2cn1 |
| InChI | InChI=1S/C27H29F2N5O4/c1-4-16(35)7-15-12-38-13-19(15)32-22-8-17-18(11-30-22)33-27(34-26(17)31-10-14-5-6-14)23-24(28)20(36-2)9-21(37-3)25(23)29/h4,8-9,11,14-15,19H,1,5-7,10,12-13H2,2-3H3,(H,30,32)(H,31,33,34)/t15-,19+/m0/s1 |
| InChIKey | LDZAGBMBGVJVRX-HNAYVOBHSA-N |
| XLogP | 4.38 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|