C26H25Cl2F2N5O4 — CID 157174132
1-[(3R,4S)-4-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(3,3-difluoroazetidin-1-yl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]but-3-en-2-one (PubChem CID 157174132) has the molecular formula C26H25Cl2F2N5O4 and a molecular weight of 580.42 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(3,3-difluoroazetidin-1-yl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]but-3-en-2-one.
| Compound Name | 1-[(3R,4S)-4-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(3,3-difluoroazetidin-1-yl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 157174132 |
| Molecular Formula | C26H25Cl2F2N5O4 |
| Molecular Weight | 580.42 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | 1-[(3R,4S)-4-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-(3,3-difluoroazetidin-1-yl)pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@H]1COC[C@H]1Nc1cc2c(N3CC(F)(F)C3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc2cn1 |
| InChI | InChI=1S/C26H25Cl2F2N5O4/c1-4-14(36)5-13-9-39-10-17(13)32-20-6-15-16(8-31-20)33-24(34-25(15)35-11-26(29,30)12-35)21-22(27)18(37-2)7-19(38-3)23(21)28/h4,6-8,13,17H,1,5,9-12H2,2-3H3,(H,31,32)/t13-,17+/m0/s1 |
| InChIKey | SLDSJVWMIUATSE-SUMWQHHRSA-N |
| XLogP | 5.04 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|