About 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine
3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine (PubChem CID 135181380) has the molecular formula C18H19N3O2
and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine.
Molecular Properties
| Compound Name | 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine |
| PubChem CID | 135181380 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine |
| SMILES | COc1cc(OC)c(C)c(-c2cc3cnc(C)cc3c(N)n2)c1 |
| InChI | InChI=1S/C18H19N3O2/c1-10-5-15-12(9-20-10)6-16(21-18(15)19)14-7-13(22-3)8-17(23-4)11(14)2/h5-9H,1-4H3,(H2,19,21) |
| InChIKey | NZVIKQUTOSDLGU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine?
The IUPAC name of 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine (CID 135181380) is 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine.
What is the SMILES notation for 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine?
The canonical SMILES for 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine is COc1cc(OC)c(C)c(-c2cc3cnc(C)cc3c(N)n2)c1.
What is the InChIKey of 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine?
The InChIKey is NZVIKQUTOSDLGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2/c1-10-5-15-12(9-20-10)6-16(21-18(15)19)14-7-13(22-3)8-17(23-4)11(14)2/h5-9H,1-4H3,(H2,19,21).
What are the key properties of 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine?
3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine has a molecular weight of 309.37 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethoxy-2-methylphenyl)-7-methyl-2,6-naphthyridin-1-amine is sourced from PubChem (CID 135181380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).