C20H21N3O4 — CID 75359779
4,6-bis(2,5-dimethoxyphenyl)pyrimidin-2-amine (PubChem CID 75359779) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 4,6-bis(2,5-dimethoxyphenyl)pyrimidin-2-amine.
| Compound Name | 4,6-bis(2,5-dimethoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 75359779 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4,6-bis(2,5-dimethoxyphenyl)pyrimidin-2-amine |
| SMILES | COc1ccc(OC)c(-c2cc(-c3cc(OC)ccc3OC)nc(N)n2)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-24-12-5-7-18(26-3)14(9-12)16-11-17(23-20(21)22-16)15-10-13(25-2)6-8-19(15)27-4/h5-11H,1-4H3,(H2,21,22,23) |
| InChIKey | QQCWTSQCJMNGCH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |