About 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine
4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine (PubChem CID 75359770) has the molecular formula C16H15N3O3
and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine |
| PubChem CID | 75359770 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine |
| SMILES | COc1ccc(OC)c(-c2cc(-c3ccco3)nc(N)n2)c1 |
| InChI | InChI=1S/C16H15N3O3/c1-20-10-5-6-14(21-2)11(8-10)12-9-13(19-16(17)18-12)15-4-3-7-22-15/h3-9H,1-2H3,(H2,17,18,19) |
| InChIKey | XSWYDQWXWNYEFB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine?
The IUPAC name of 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine (CID 75359770) is 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine.
What is the SMILES notation for 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine?
The canonical SMILES for 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine is COc1ccc(OC)c(-c2cc(-c3ccco3)nc(N)n2)c1.
What is the InChIKey of 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine?
The InChIKey is XSWYDQWXWNYEFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3/c1-20-10-5-6-14(21-2)11(8-10)12-9-13(19-16(17)18-12)15-4-3-7-22-15/h3-9H,1-2H3,(H2,17,18,19).
What are the key properties of 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine?
4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine has a molecular weight of 297.31 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine is sourced from PubChem (CID 75359770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).