C16H15N3O3 — CID 75359770
4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine (PubChem CID 75359770) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 75359770 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-6-(furan-2-yl)pyrimidin-2-amine |
| SMILES | COc1ccc(OC)c(-c2cc(-c3ccco3)nc(N)n2)c1 |
| InChI | InChI=1S/C16H15N3O3/c1-20-10-5-6-14(21-2)11(8-10)12-9-13(19-16(17)18-12)15-4-3-7-22-15/h3-9H,1-2H3,(H2,17,18,19) |
| InChIKey | XSWYDQWXWNYEFB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |