C11H13N3O2 — CID 121232340
5,7-dimethoxy-2-methylquinazolin-4-amine (PubChem CID 121232340) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 5,7-dimethoxy-2-methylquinazolin-4-amine.
| Compound Name | 5,7-dimethoxy-2-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 121232340 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 5,7-dimethoxy-2-methylquinazolin-4-amine |
| SMILES | COc1cc(OC)c2c(N)nc(C)nc2c1 |
| InChI | InChI=1S/C11H13N3O2/c1-6-13-8-4-7(15-2)5-9(16-3)10(8)11(12)14-6/h4-5H,1-3H3,(H2,12,13,14) |
| InChIKey | PEONOLDCBGBXHC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |