C13H11NO6 — CID 11000344
5,7-dimethoxyquinoline-2,4-dicarboxylic acid (PubChem CID 11000344) has the molecular formula C13H11NO6 and a molecular weight of 277.23 g/mol. Its IUPAC name is 5,7-dimethoxyquinoline-2,4-dicarboxylic acid.
| Compound Name | 5,7-dimethoxyquinoline-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 11000344 |
| Molecular Formula | C13H11NO6 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5,7-dimethoxyquinoline-2,4-dicarboxylic acid |
| SMILES | COc1cc(OC)c2c(C(=O)O)cc(C(=O)O)nc2c1 |
| InChI | InChI=1S/C13H11NO6/c1-19-6-3-8-11(10(4-6)20-2)7(12(15)16)5-9(14-8)13(17)18/h3-5H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | LIZGQRCHGQCPBJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |