8,10-dimethoxyphenanthridine-4-carboxylic acid

C16H13NO4 — CID 101486809

IUPAC8,10-dimethoxyphenanthridine-4-carboxylic acid
SMILESCOc1cc(OC)c2c(cnc3c(C(=O)O)cccc32)c1
InChIInChI=1S/C16H13NO4/c1-20-10-6-9-8-17-15-11(14(9)13(7-10)21-2)4-3-5-12(15)16(18)19/h3-8H,1-2H3,(H,18,19)
InChIKeyJVKLGRIFONUFFD-UHFFFAOYSA-N
MW283.28 g/mol
LogP3.10
Rot. Bonds3

About 8,10-dimethoxyphenanthridine-4-carboxylic acid

8,10-dimethoxyphenanthridine-4-carboxylic acid (PubChem CID 101486809) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 8,10-dimethoxyphenanthridine-4-carboxylic acid.

Molecular Properties

Compound Name8,10-dimethoxyphenanthridine-4-carboxylic acid
PubChem CID101486809
Molecular FormulaC16H13NO4
Molecular Weight283.28 g/mol
Exact Mass283.08
IUPAC Name8,10-dimethoxyphenanthridine-4-carboxylic acid
SMILESCOc1cc(OC)c2c(cnc3c(C(=O)O)cccc32)c1
InChIInChI=1S/C16H13NO4/c1-20-10-6-9-8-17-15-11(14(9)13(7-10)21-2)4-3-5-12(15)16(18)19/h3-8H,1-2H3,(H,18,19)
InChIKeyJVKLGRIFONUFFD-UHFFFAOYSA-N
XLogP3.10
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.28
LogP ≤ 53.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze 8,10-dimethoxyphenanthridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-[(2,4-dimethoxyphenyl)methylamino]quinazoline-8-carboxylic acid
CID 67042839
8-methoxy-2-methylsulfonylquinoline-4-carboxylic acid
CID 15179627
3,5-dimethoxy-2-(phenoxymethoxy)benzoic acid
CID 70362441
4-chloro-8-methoxyquinoline-3-carboxylic acid;hydrochloride
CID 67617550
5,7-dimethoxyquinoline-2,4-dicarboxylic acid
CID 11000344
5-methoxynaphthalene-2,3-dicarboxylic acid
CID 10467078
2,4-dimethoxybenzoic acid
CID 7052
2,4-dimethoxybenzoic acid
CID 67450326
6,8-dimethoxy-1-(3-oxo-1H-isoindole-2-carbonyl)isoquinoline-4-carboxylic acid
CID 68613498
2-(2,5-dimethoxyphenyl)-8-(trifluoromethyl)quinoline-4-carboxylic acid
CID 3469599
8-methoxy-4-pyrrolidin-1-ylquinoline-3-carboxylic acid
CID 39732432
2-(2,4-dimethoxyphenyl)pyridine-3-carboxylic acid
CID 53223736

Frequently Asked Questions

What is the IUPAC name of 8,10-dimethoxyphenanthridine-4-carboxylic acid?
The IUPAC name of 8,10-dimethoxyphenanthridine-4-carboxylic acid (CID 101486809) is 8,10-dimethoxyphenanthridine-4-carboxylic acid.
What is the SMILES notation for 8,10-dimethoxyphenanthridine-4-carboxylic acid?
The canonical SMILES for 8,10-dimethoxyphenanthridine-4-carboxylic acid is COc1cc(OC)c2c(cnc3c(C(=O)O)cccc32)c1.
What is the InChIKey of 8,10-dimethoxyphenanthridine-4-carboxylic acid?
The InChIKey is JVKLGRIFONUFFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO4/c1-20-10-6-9-8-17-15-11(14(9)13(7-10)21-2)4-3-5-12(15)16(18)19/h3-8H,1-2H3,(H,18,19).
What are the key properties of 8,10-dimethoxyphenanthridine-4-carboxylic acid?
8,10-dimethoxyphenanthridine-4-carboxylic acid has a molecular weight of 283.28 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,10-dimethoxyphenanthridine-4-carboxylic acid is sourced from PubChem (CID 101486809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).