C17H14BrNO4 — CID 3148947
methyl 7-bromo-1,3-dimethoxyacridine-9-carboxylate (PubChem CID 3148947) has the molecular formula C17H14BrNO4 and a molecular weight of 376.21 g/mol. Its IUPAC name is methyl 7-bromo-1,3-dimethoxyacridine-9-carboxylate.
| Compound Name | methyl 7-bromo-1,3-dimethoxyacridine-9-carboxylate |
|---|---|
| PubChem CID | 3148947 |
| Molecular Formula | C17H14BrNO4 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | methyl 7-bromo-1,3-dimethoxyacridine-9-carboxylate |
| SMILES | COC(=O)c1c2cc(Br)ccc2nc2cc(OC)cc(OC)c12 |
| InChI | InChI=1S/C17H14BrNO4/c1-21-10-7-13-16(14(8-10)22-2)15(17(20)23-3)11-6-9(18)4-5-12(11)19-13/h4-8H,1-3H3 |
| InChIKey | CTGXMIRNWPCHLD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|