C20H12Br2O4S — CID 101406188
dimethyl 6,9-dibromophenanthro[9,10-c]thiophene-1,3-dicarboxylate (PubChem CID 101406188) has the molecular formula C20H12Br2O4S and a molecular weight of 508.19 g/mol. Its IUPAC name is dimethyl 6,9-dibromophenanthro[9,10-c]thiophene-1,3-dicarboxylate.
| Compound Name | dimethyl 6,9-dibromophenanthro[9,10-c]thiophene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101406188 |
| Molecular Formula | C20H12Br2O4S |
| Molecular Weight | 508.19 g/mol |
| Exact Mass | 505.88 |
| IUPAC Name | dimethyl 6,9-dibromophenanthro[9,10-c]thiophene-1,3-dicarboxylate |
| SMILES | COC(=O)c1sc(C(=O)OC)c2c3ccc(Br)cc3c3cc(Br)ccc3c12 |
| InChI | InChI=1S/C20H12Br2O4S/c1-25-19(23)17-15-11-5-3-9(21)7-13(11)14-8-10(22)4-6-12(14)16(15)18(27-17)20(24)26-2/h3-8H,1-2H3 |
| InChIKey | VXSFRDGSBHYCAY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.19 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|