methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate

C18H12BrNO2S — CID 71023298

IUPACmethyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate
SMILESCOC(=O)c1sccc1-n1c2ccccc2c2cc(Br)ccc21
InChIInChI=1S/C18H12BrNO2S/c1-22-18(21)17-16(8-9-23-17)20-14-5-3-2-4-12(14)13-10-11(19)6-7-15(13)20/h2-10H,1H3
InChIKeyJLZKINUKGMMNSN-UHFFFAOYSA-N
MW386.27 g/mol
LogP5.39
Rot. Bonds2

About methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate

methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate (PubChem CID 71023298) has the molecular formula C18H12BrNO2S and a molecular weight of 386.27 g/mol. Its IUPAC name is methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate
PubChem CID71023298
Molecular FormulaC18H12BrNO2S
Molecular Weight386.27 g/mol
Exact Mass384.98
IUPAC Namemethyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate
SMILESCOC(=O)c1sccc1-n1c2ccccc2c2cc(Br)ccc21
InChIInChI=1S/C18H12BrNO2S/c1-22-18(21)17-16(8-9-23-17)20-14-5-3-2-4-12(14)13-10-11(19)6-7-15(13)20/h2-10H,1H3
InChIKeyJLZKINUKGMMNSN-UHFFFAOYSA-N
XLogP5.39
TPSA31.23 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500386.27
LogP ≤ 55.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate?
The IUPAC name of methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate (CID 71023298) is methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate?
The canonical SMILES for methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate is COC(=O)c1sccc1-n1c2ccccc2c2cc(Br)ccc21.
What is the InChIKey of methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate?
The InChIKey is JLZKINUKGMMNSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrNO2S/c1-22-18(21)17-16(8-9-23-17)20-14-5-3-2-4-12(14)13-10-11(19)6-7-15(13)20/h2-10H,1H3.
What are the key properties of methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate?
methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate has a molecular weight of 386.27 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-bromocarbazol-9-yl)thiophene-2-carboxylate is sourced from PubChem (CID 71023298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).