C16H17NO6 — CID 12785004
4-methoxy-6-(3,4,5-trimethoxyphenyl)pyridine-2-carboxylic acid (PubChem CID 12785004) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is 4-methoxy-6-(3,4,5-trimethoxyphenyl)pyridine-2-carboxylic acid.
| Compound Name | 4-methoxy-6-(3,4,5-trimethoxyphenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 12785004 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-methoxy-6-(3,4,5-trimethoxyphenyl)pyridine-2-carboxylic acid |
| SMILES | COc1cc(C(=O)O)nc(-c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C16H17NO6/c1-20-10-7-11(17-12(8-10)16(18)19)9-5-13(21-2)15(23-4)14(6-9)22-3/h5-8H,1-4H3,(H,18,19) |
| InChIKey | UPSNIZUBIQNSEM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |