benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid

C22H22N2O5 — CID 20537523

IUPACbenzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid
SMILESCOc1cc(C(=O)O)nc(-c2ccc(C)cc2)c1.NC(=O)OCc1ccccc1
InChIInChI=1S/C14H13NO3.C8H9NO2/c1-9-3-5-10(6-4-9)12-7-11(18-2)8-13(15-12)14(16)17;9-8(10)11-6-7-4-2-1-3-5-7/h3-8H,1-2H3,(H,16,17);1-5H,6H2,(H2,9,10)
InChIKeyBSWFVUYHCVGFKH-UHFFFAOYSA-N
MW394.43 g/mol
LogP4.05
Rot. Bonds5

About benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid

benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid (PubChem CID 20537523) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid.

Molecular Properties

Compound Namebenzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid
PubChem CID20537523
Molecular FormulaC22H22N2O5
Molecular Weight394.43 g/mol
Exact Mass394.15
IUPAC Namebenzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid
SMILESCOc1cc(C(=O)O)nc(-c2ccc(C)cc2)c1.NC(=O)OCc1ccccc1
InChIInChI=1S/C14H13NO3.C8H9NO2/c1-9-3-5-10(6-4-9)12-7-11(18-2)8-13(15-12)14(16)17;9-8(10)11-6-7-4-2-1-3-5-7/h3-8H,1-2H3,(H,16,17);1-5H,6H2,(H2,9,10)
InChIKeyBSWFVUYHCVGFKH-UHFFFAOYSA-N
XLogP4.05
TPSA111.74 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500394.43
LogP ≤ 54.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid?
The IUPAC name of benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid (CID 20537523) is benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid.
What is the SMILES notation for benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid?
The canonical SMILES for benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid is COc1cc(C(=O)O)nc(-c2ccc(C)cc2)c1.NC(=O)OCc1ccccc1.
What is the InChIKey of benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid?
The InChIKey is BSWFVUYHCVGFKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3.C8H9NO2/c1-9-3-5-10(6-4-9)12-7-11(18-2)8-13(15-12)14(16)17;9-8(10)11-6-7-4-2-1-3-5-7/h3-8H,1-2H3,(H,16,17);1-5H,6H2,(H2,9,10).
What are the key properties of benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid?
benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid has a molecular weight of 394.43 g/mol, XLogP of 4.05, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 20537523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).