C22H22N2O5 — CID 20537523
benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid (PubChem CID 20537523) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid.
| Compound Name | benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 20537523 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | benzyl carbamate;4-methoxy-6-(4-methylphenyl)pyridine-2-carboxylic acid |
| SMILES | COc1cc(C(=O)O)nc(-c2ccc(C)cc2)c1.NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H13NO3.C8H9NO2/c1-9-3-5-10(6-4-9)12-7-11(18-2)8-13(15-12)14(16)17;9-8(10)11-6-7-4-2-1-3-5-7/h3-8H,1-2H3,(H,16,17);1-5H,6H2,(H2,9,10) |
| InChIKey | BSWFVUYHCVGFKH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |