About methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide
methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide (PubChem CID 20537542) has the molecular formula C23H24N2O4
and a molecular weight of 392.46 g/mol. Its IUPAC name is methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide.
Molecular Properties
| Compound Name | methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide |
| PubChem CID | 20537542 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide |
| SMILES | CCOc1cc(C(=O)OC)nc(-c2ccccc2)c1.NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H15NO3.C8H9NO/c1-3-19-12-9-13(11-7-5-4-6-8-11)16-14(10-12)15(17)18-2;9-8(10)6-7-4-2-1-3-5-7/h4-10H,3H2,1-2H3;1-5H,6H2,(H2,9,10) |
| InChIKey | MFNOXODCBFVBOG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide?
The IUPAC name of methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide (CID 20537542) is methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide.
What is the SMILES notation for methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide?
The canonical SMILES for methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide is CCOc1cc(C(=O)OC)nc(-c2ccccc2)c1.NC(=O)Cc1ccccc1.
What is the InChIKey of methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide?
The InChIKey is MFNOXODCBFVBOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3.C8H9NO/c1-3-19-12-9-13(11-7-5-4-6-8-11)16-14(10-12)15(17)18-2;9-8(10)6-7-4-2-1-3-5-7/h4-10H,3H2,1-2H3;1-5H,6H2,(H2,9,10).
What are the key properties of methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide?
methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide has a molecular weight of 392.46 g/mol, XLogP of 3.65, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-ethoxy-6-phenylpyridine-2-carboxylate;2-phenylacetamide is sourced from PubChem (CID 20537542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).