About ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate
ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate (PubChem CID 143874733) has the molecular formula C16H18ClNO2
and a molecular weight of 291.78 g/mol. Its IUPAC name is ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate |
| PubChem CID | 143874733 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate |
| SMILES | CC.CCOC(=O)c1cc(Cl)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H12ClNO2.C2H6/c1-2-18-14(17)13-9-11(15)8-12(16-13)10-6-4-3-5-7-10;1-2/h3-9H,2H2,1H3;1-2H3 |
| InChIKey | SUZPTNXIXNRAKL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate?
The IUPAC name of ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate (CID 143874733) is ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate.
What is the SMILES notation for ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate?
The canonical SMILES for ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate is CC.CCOC(=O)c1cc(Cl)cc(-c2ccccc2)n1.
What is the InChIKey of ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate?
The InChIKey is SUZPTNXIXNRAKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNO2.C2H6/c1-2-18-14(17)13-9-11(15)8-12(16-13)10-6-4-3-5-7-10;1-2/h3-9H,2H2,1H3;1-2H3.
What are the key properties of ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate?
ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate has a molecular weight of 291.78 g/mol, XLogP of 4.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 4-chloro-6-phenylpyridine-2-carboxylate is sourced from PubChem (CID 143874733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).