About ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium
ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium (PubChem CID 134840915) has the molecular formula C13H11N2O2Y-
and a molecular weight of 316.15 g/mol. Its IUPAC name is ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium.
Molecular Properties
| Compound Name | ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium |
| PubChem CID | 134840915 |
| Molecular Formula | C13H11N2O2Y- |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n[c-]n1.[Y] |
| InChI | InChI=1S/C13H11N2O2.Y/c1-2-17-13(16)12-8-11(14-9-15-12)10-6-4-3-5-7-10;/h3-8H,2H2,1H3;/q-1; |
| InChIKey | YIVKFCLKHARVTO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium?
The IUPAC name of ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium (CID 134840915) is ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium.
What is the SMILES notation for ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium?
The canonical SMILES for ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium is CCOC(=O)c1cc(-c2ccccc2)n[c-]n1.[Y].
What is the InChIKey of ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium?
The InChIKey is YIVKFCLKHARVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N2O2.Y/c1-2-17-13(16)12-8-11(14-9-15-12)10-6-4-3-5-7-10;/h3-8H,2H2,1H3;/q-1;.
What are the key properties of ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium?
ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium has a molecular weight of 316.15 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-phenyl-2H-pyrimidin-2-ide-4-carboxylate;yttrium is sourced from PubChem (CID 134840915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).