C15H13Cl2NO4 — CID 19747565
diethyl 5,7-dichloroquinoline-2,4-dicarboxylate (PubChem CID 19747565) has the molecular formula C15H13Cl2NO4 and a molecular weight of 342.18 g/mol. Its IUPAC name is diethyl 5,7-dichloroquinoline-2,4-dicarboxylate.
| Compound Name | diethyl 5,7-dichloroquinoline-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19747565 |
| Molecular Formula | C15H13Cl2NO4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | diethyl 5,7-dichloroquinoline-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C15H13Cl2NO4/c1-3-21-14(19)9-7-12(15(20)22-4-2)18-11-6-8(16)5-10(17)13(9)11/h5-7H,3-4H2,1-2H3 |
| InChIKey | SBYVSXWAKJZJJU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |