2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid

C16H15NO6 — CID 71486114

IUPAC2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid
SMILESCCOC(=O)c1cc(C(=O)OCC)c2cc(C(=O)O)ccc2n1
InChIInChI=1S/C16H15NO6/c1-3-22-15(20)11-8-13(16(21)23-4-2)17-12-6-5-9(14(18)19)7-10(11)12/h5-8H,3-4H2,1-2H3,(H,18,19)
InChIKeyNYVQBDXQMGXFSX-UHFFFAOYSA-N
MW317.30 g/mol
LogP2.29
Rot. Bonds5

About 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid

2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid (PubChem CID 71486114) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid.

Molecular Properties

Compound Name2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid
PubChem CID71486114
Molecular FormulaC16H15NO6
Molecular Weight317.30 g/mol
Exact Mass317.09
IUPAC Name2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid
SMILESCCOC(=O)c1cc(C(=O)OCC)c2cc(C(=O)O)ccc2n1
InChIInChI=1S/C16H15NO6/c1-3-22-15(20)11-8-13(16(21)23-4-2)17-12-6-5-9(14(18)19)7-10(11)12/h5-8H,3-4H2,1-2H3,(H,18,19)
InChIKeyNYVQBDXQMGXFSX-UHFFFAOYSA-N
XLogP2.29
TPSA102.79 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.30
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid?
The IUPAC name of 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid (CID 71486114) is 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid.
What is the SMILES notation for 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid?
The canonical SMILES for 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid is CCOC(=O)c1cc(C(=O)OCC)c2cc(C(=O)O)ccc2n1.
What is the InChIKey of 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid?
The InChIKey is NYVQBDXQMGXFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO6/c1-3-22-15(20)11-8-13(16(21)23-4-2)17-12-6-5-9(14(18)19)7-10(11)12/h5-8H,3-4H2,1-2H3,(H,18,19).
What are the key properties of 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid?
2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid has a molecular weight of 317.30 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(ethoxycarbonyl)quinoline-6-carboxylic acid is sourced from PubChem (CID 71486114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).