C28H24Cl2N2O2 — CID 171976518
ethyl 5,7-dichloro-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylamino)quinoline-2-carboxylate (PubChem CID 171976518) has the molecular formula C28H24Cl2N2O2 and a molecular weight of 491.42 g/mol. Its IUPAC name is ethyl 5,7-dichloro-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylamino)quinoline-2-carboxylate.
| Compound Name | ethyl 5,7-dichloro-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylamino)quinoline-2-carboxylate |
|---|---|
| PubChem CID | 171976518 |
| Molecular Formula | C28H24Cl2N2O2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | ethyl 5,7-dichloro-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylamino)quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1cc(NCC2c3ccccc3CCc3ccccc32)c2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C28H24Cl2N2O2/c1-2-34-28(33)26-15-24(27-23(30)13-19(29)14-25(27)32-26)31-16-22-20-9-5-3-7-17(20)11-12-18-8-4-6-10-21(18)22/h3-10,13-15,22H,2,11-12,16H2,1H3,(H,31,32) |
| InChIKey | ZKENNFHJZQHBPS-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |