C14H16Cl2N2O2 — CID 143442535
ethane;ethyl 4-amino-5,7-dichloroquinoline-2-carboxylate (PubChem CID 143442535) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is ethane;ethyl 4-amino-5,7-dichloroquinoline-2-carboxylate.
| Compound Name | ethane;ethyl 4-amino-5,7-dichloroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 143442535 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | ethane;ethyl 4-amino-5,7-dichloroquinoline-2-carboxylate |
| SMILES | CC.CCOC(=O)c1cc(N)c2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C12H10Cl2N2O2.C2H6/c1-2-18-12(17)10-5-8(15)11-7(14)3-6(13)4-9(11)16-10;1-2/h3-5H,2H2,1H3,(H2,15,16);1-2H3 |
| InChIKey | DXSIGFQRVITCNS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |